C11H9BrO4 — CID 123486915
ethyl 5-bromo-3-hydroxy-1-benzofuran-2-carboxylate (PubChem CID 123486915) has the molecular formula C11H9BrO4 and a molecular weight of 285.09 g/mol. Its IUPAC name is ethyl 5-bromo-3-hydroxy-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-bromo-3-hydroxy-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 123486915 |
| Molecular Formula | C11H9BrO4 |
| Molecular Weight | 285.09 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | ethyl 5-bromo-3-hydroxy-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(Br)cc2c1O |
| InChI | InChI=1S/C11H9BrO4/c1-2-15-11(14)10-9(13)7-5-6(12)3-4-8(7)16-10/h3-5,13H,2H2,1H3 |
| InChIKey | LLFXIUKWAJRTEF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.09 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |