C18H17BrO5 — CID 7542606
ethyl 5-bromo-3-[[(2E,4E)-hexa-2,4-dienoyl]oxymethyl]-1-benzofuran-2-carboxylate (PubChem CID 7542606) has the molecular formula C18H17BrO5 and a molecular weight of 393.23 g/mol. Its IUPAC name is ethyl 5-bromo-3-[[(2E,4E)-hexa-2,4-dienoyl]oxymethyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-bromo-3-[[(2E,4E)-hexa-2,4-dienoyl]oxymethyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 7542606 |
| Molecular Formula | C18H17BrO5 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | ethyl 5-bromo-3-[[(2E,4E)-hexa-2,4-dienoyl]oxymethyl]-1-benzofuran-2-carboxylate |
| SMILES | C/C=C/C=C/C(=O)OCc1c(C(=O)OCC)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C18H17BrO5/c1-3-5-6-7-16(20)23-11-14-13-10-12(19)8-9-15(13)24-17(14)18(21)22-4-2/h3,5-10H,4,11H2,1-2H3/b5-3+,7-6+ |
| InChIKey | SQVMABLBFUGKFX-TWTPFVCWSA-N |
| XLogP | 4.55 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|