C20H20BrNO6S — CID 41153537
(5-bromo-2-ethoxycarbonyl-1-benzofuran-3-yl)methyl (3S,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 41153537) has the molecular formula C20H20BrNO6S and a molecular weight of 482.35 g/mol. Its IUPAC name is (5-bromo-2-ethoxycarbonyl-1-benzofuran-3-yl)methyl (3S,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | (5-bromo-2-ethoxycarbonyl-1-benzofuran-3-yl)methyl (3S,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 41153537 |
| Molecular Formula | C20H20BrNO6S |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 481.02 |
| IUPAC Name | (5-bromo-2-ethoxycarbonyl-1-benzofuran-3-yl)methyl (3S,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(Br)cc2c1COC(=O)[C@H]1CS[C@]2(C)CCC(=O)N12 |
| InChI | InChI=1S/C20H20BrNO6S/c1-3-26-19(25)17-13(12-8-11(21)4-5-15(12)28-17)9-27-18(24)14-10-29-20(2)7-6-16(23)22(14)20/h4-5,8,14H,3,6-7,9-10H2,1-2H3/t14-,20-/m1/s1 |
| InChIKey | DLLSQIVYIKXIKZ-JLTOFOAXSA-N |
| XLogP | 3.87 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |