C16H19NO3S — CID 7822528
(4-methylphenyl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7822528) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is (4-methylphenyl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | (4-methylphenyl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7822528 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (4-methylphenyl)methyl (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | Cc1ccc(COC(=O)[C@@H]2CS[C@@]3(C)CCC(=O)N23)cc1 |
| InChI | InChI=1S/C16H19NO3S/c1-11-3-5-12(6-4-11)9-20-15(19)13-10-21-16(2)8-7-14(18)17(13)16/h3-6,13H,7-10H2,1-2H3/t13-,16-/m0/s1 |
| InChIKey | ZZMWGWCANWRUEB-BBRMVZONSA-N |
| XLogP | 2.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |