C16H16ClN3O3S — CID 7822573
(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7822573) has the molecular formula C16H16ClN3O3S and a molecular weight of 365.84 g/mol. Its IUPAC name is (6-chloroimidazo[1,2-a]pyridin-2-yl)methyl (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | (6-chloroimidazo[1,2-a]pyridin-2-yl)methyl (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7822573 |
| Molecular Formula | C16H16ClN3O3S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (6-chloroimidazo[1,2-a]pyridin-2-yl)methyl (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | C[C@@]12CCC(=O)N1[C@H](C(=O)OCc1cn3cc(Cl)ccc3n1)CS2 |
| InChI | InChI=1S/C16H16ClN3O3S/c1-16-5-4-14(21)20(16)12(9-24-16)15(22)23-8-11-7-19-6-10(17)2-3-13(19)18-11/h2-3,6-7,12H,4-5,8-9H2,1H3/t12-,16+/m0/s1 |
| InChIKey | GHVFMRHXIFBPEN-BLLLJJGKSA-N |
| XLogP | 2.48 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |