C17H16BrN3O5S2 — CID 55637385
ethyl 5-bromo-3-[[5-(ethoxycarbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-benzofuran-2-carboxylate (PubChem CID 55637385) has the molecular formula C17H16BrN3O5S2 and a molecular weight of 486.37 g/mol. Its IUPAC name is ethyl 5-bromo-3-[[5-(ethoxycarbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-bromo-3-[[5-(ethoxycarbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 55637385 |
| Molecular Formula | C17H16BrN3O5S2 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 484.97 |
| IUPAC Name | ethyl 5-bromo-3-[[5-(ethoxycarbonylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)Nc1nnc(SCc2c(C(=O)OCC)oc3ccc(Br)cc23)s1 |
| InChI | InChI=1S/C17H16BrN3O5S2/c1-3-24-14(22)13-11(10-7-9(18)5-6-12(10)26-13)8-27-17-21-20-15(28-17)19-16(23)25-4-2/h5-7H,3-4,8H2,1-2H3,(H,19,20,23) |
| InChIKey | UDBRKSHUIJRNMD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 103.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|