C20H21ClNO3+ — CID 9307443
[(1S)-1-(3-chlorophenyl)ethyl]-[(2-ethoxycarbonyl-1-benzofuran-3-yl)methyl]azanium (PubChem CID 9307443) has the molecular formula C20H21ClNO3+ and a molecular weight of 358.85 g/mol. Its IUPAC name is [(1S)-1-(3-chlorophenyl)ethyl]-[(2-ethoxycarbonyl-1-benzofuran-3-yl)methyl]azanium.
| Compound Name | [(1S)-1-(3-chlorophenyl)ethyl]-[(2-ethoxycarbonyl-1-benzofuran-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 9307443 |
| Molecular Formula | C20H21ClNO3+ |
| Molecular Weight | 358.85 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | [(1S)-1-(3-chlorophenyl)ethyl]-[(2-ethoxycarbonyl-1-benzofuran-3-yl)methyl]azanium |
| SMILES | CCOC(=O)c1oc2ccccc2c1C[NH2+][C@@H](C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H20ClNO3/c1-3-24-20(23)19-17(16-9-4-5-10-18(16)25-19)12-22-13(2)14-7-6-8-15(21)11-14/h4-11,13,22H,3,12H2,1-2H3/p+1/t13-/m0/s1 |
| InChIKey | PDZAFCIMRFGWJC-ZDUSSCGKSA-O |
| XLogP | 4.09 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.85 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |