C20H17ClO6 — CID 16560190
ethyl 3-[[2-(4-chlorophenoxy)acetyl]oxymethyl]-1-benzofuran-2-carboxylate (PubChem CID 16560190) has the molecular formula C20H17ClO6 and a molecular weight of 388.80 g/mol. Its IUPAC name is ethyl 3-[[2-(4-chlorophenoxy)acetyl]oxymethyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[[2-(4-chlorophenoxy)acetyl]oxymethyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 16560190 |
| Molecular Formula | C20H17ClO6 |
| Molecular Weight | 388.80 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | ethyl 3-[[2-(4-chlorophenoxy)acetyl]oxymethyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1COC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClO6/c1-2-24-20(23)19-16(15-5-3-4-6-17(15)27-19)11-26-18(22)12-25-14-9-7-13(21)8-10-14/h3-10H,2,11-12H2,1H3 |
| InChIKey | DOAMTVQHZJLTAM-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.80 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |