C18H21ClN2O4 — CID 1281686
ethyl 5-chloro-3-[(2-piperidin-1-ylacetyl)amino]-1-benzofuran-2-carboxylate (PubChem CID 1281686) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is ethyl 5-chloro-3-[(2-piperidin-1-ylacetyl)amino]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-chloro-3-[(2-piperidin-1-ylacetyl)amino]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 1281686 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | ethyl 5-chloro-3-[(2-piperidin-1-ylacetyl)amino]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(Cl)cc2c1NC(=O)CN1CCCCC1 |
| InChI | InChI=1S/C18H21ClN2O4/c1-2-24-18(23)17-16(13-10-12(19)6-7-14(13)25-17)20-15(22)11-21-8-4-3-5-9-21/h6-7,10H,2-5,8-9,11H2,1H3,(H,20,22) |
| InChIKey | ATWIWZAKFULVFS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |