C20H15ClO6 — CID 11784013
methyl (2R,4R)-9-chloro-2-hydroxy-5-oxo-4-phenyl-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate (PubChem CID 11784013) has the molecular formula C20H15ClO6 and a molecular weight of 386.79 g/mol. Its IUPAC name is methyl (2R,4R)-9-chloro-2-hydroxy-5-oxo-4-phenyl-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate.
| Compound Name | methyl (2R,4R)-9-chloro-2-hydroxy-5-oxo-4-phenyl-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate |
|---|---|
| PubChem CID | 11784013 |
| Molecular Formula | C20H15ClO6 |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | methyl (2R,4R)-9-chloro-2-hydroxy-5-oxo-4-phenyl-3,4-dihydropyrano[3,2-c]chromene-2-carboxylate |
| SMILES | COC(=O)[C@@]1(O)C[C@H](c2ccccc2)c2c(c3cc(Cl)ccc3oc2=O)O1 |
| InChI | InChI=1S/C20H15ClO6/c1-25-19(23)20(24)10-14(11-5-3-2-4-6-11)16-17(27-20)13-9-12(21)7-8-15(13)26-18(16)22/h2-9,14,24H,10H2,1H3/t14-,20-/m1/s1 |
| InChIKey | BCIIEDMNQCCCKH-JLTOFOAXSA-N |
| XLogP | 3.22 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|