C19H16O3Se — CID 132599116
(1S,4S)-1-hydroxy-4-phenylselanyl-1,2,3,4-tetrahydroxanthen-9-one (PubChem CID 132599116) has the molecular formula C19H16O3Se and a molecular weight of 371.29 g/mol. Its IUPAC name is (1S,4S)-1-hydroxy-4-phenylselanyl-1,2,3,4-tetrahydroxanthen-9-one.
| Compound Name | (1S,4S)-1-hydroxy-4-phenylselanyl-1,2,3,4-tetrahydroxanthen-9-one |
|---|---|
| PubChem CID | 132599116 |
| Molecular Formula | C19H16O3Se |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | (1S,4S)-1-hydroxy-4-phenylselanyl-1,2,3,4-tetrahydroxanthen-9-one |
| SMILES | O=c1c2c(oc3ccccc13)[C@@H]([Se]c1ccccc1)CC[C@@H]2O |
| InChI | InChI=1S/C19H16O3Se/c20-14-10-11-16(23-12-6-2-1-3-7-12)19-17(14)18(21)13-8-4-5-9-15(13)22-19/h1-9,14,16,20H,10-11H2/t14-,16-/m0/s1 |
| InChIKey | YQSSZEKKQVKBBM-HOCLYGCPSA-N |
| XLogP | 2.69 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|