C12H10O4 — CID 154631405
(3S,4S)-3,4-dihydroxy-3,4-dihydro-2H-dibenzofuran-1-one (PubChem CID 154631405) has the molecular formula C12H10O4 and a molecular weight of 218.21 g/mol. Its IUPAC name is (3S,4S)-3,4-dihydroxy-3,4-dihydro-2H-dibenzofuran-1-one.
| Compound Name | (3S,4S)-3,4-dihydroxy-3,4-dihydro-2H-dibenzofuran-1-one |
|---|---|
| PubChem CID | 154631405 |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | (3S,4S)-3,4-dihydroxy-3,4-dihydro-2H-dibenzofuran-1-one |
| SMILES | O=C1C[C@H](O)[C@H](O)c2oc3ccccc3c21 |
| InChI | InChI=1S/C12H10O4/c13-7-5-8(14)11(15)12-10(7)6-3-1-2-4-9(6)16-12/h1-4,8,11,14-15H,5H2/t8-,11-/m0/s1 |
| InChIKey | PPMRLTHZJFWYBV-KWQFWETISA-N |
| XLogP | 1.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |