C21H20O6 — CID 132599118
(1R,3S,4S)-3,4-dihydroxy-1-[(4-methoxyphenyl)methoxy]-1,2,3,4-tetrahydroxanthen-9-one (PubChem CID 132599118) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is (1R,3S,4S)-3,4-dihydroxy-1-[(4-methoxyphenyl)methoxy]-1,2,3,4-tetrahydroxanthen-9-one.
| Compound Name | (1R,3S,4S)-3,4-dihydroxy-1-[(4-methoxyphenyl)methoxy]-1,2,3,4-tetrahydroxanthen-9-one |
|---|---|
| PubChem CID | 132599118 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (1R,3S,4S)-3,4-dihydroxy-1-[(4-methoxyphenyl)methoxy]-1,2,3,4-tetrahydroxanthen-9-one |
| SMILES | COc1ccc(CO[C@@H]2C[C@H](O)[C@H](O)c3oc4ccccc4c(=O)c32)cc1 |
| InChI | InChI=1S/C21H20O6/c1-25-13-8-6-12(7-9-13)11-26-17-10-15(22)20(24)21-18(17)19(23)14-4-2-3-5-16(14)27-21/h2-9,15,17,20,22,24H,10-11H2,1H3/t15-,17+,20-/m0/s1 |
| InChIKey | CAUXUGNBQWESNY-VPWXQRGCSA-N |
| XLogP | 2.86 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |