C34H26N2O2P+ — CID 164677123
(1R,1'R)-1,1'-diphenyl-3,3'-spirobi[1,2-dihydrobenzo[f][1,3,2]benzoxazaphosphinin-3-ium] (PubChem CID 164677123) has the molecular formula C34H26N2O2P+ and a molecular weight of 525.57 g/mol. Its IUPAC name is (1R,1'R)-1,1'-diphenyl-3,3'-spirobi[1,2-dihydrobenzo[f][1,3,2]benzoxazaphosphinin-3-ium].
| Compound Name | (1R,1'R)-1,1'-diphenyl-3,3'-spirobi[1,2-dihydrobenzo[f][1,3,2]benzoxazaphosphinin-3-ium] |
|---|---|
| PubChem CID | 164677123 |
| Molecular Formula | C34H26N2O2P+ |
| Molecular Weight | 525.57 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | (1R,1'R)-1,1'-diphenyl-3,3'-spirobi[1,2-dihydrobenzo[f][1,3,2]benzoxazaphosphinin-3-ium] |
| SMILES | c1ccc([C@H]2N[P+]3(N[C@H](c4ccccc4)c4c(ccc5ccccc45)O3)Oc3ccc4ccccc4c32)cc1 |
| InChI | InChI=1S/C34H26N2O2P/c1-3-13-25(14-4-1)33-31-27-17-9-7-11-23(27)19-21-29(31)37-39(35-33)36-34(26-15-5-2-6-16-26)32-28-18-10-8-12-24(28)20-22-30(32)38-39/h1-22,33-36H/q+1/t33-,34-,39?/m1/s1 |
| InChIKey | KRWQUUKIVUBWCI-GLIDJFGMSA-N |
| XLogP | 8.51 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.57 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|