C18H14N2O — CID 6936217
(1S)-1-phenyl-2,4-dihydro-1H-benzo[f]quinazolin-3-one (PubChem CID 6936217) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is (1S)-1-phenyl-2,4-dihydro-1H-benzo[f]quinazolin-3-one.
| Compound Name | (1S)-1-phenyl-2,4-dihydro-1H-benzo[f]quinazolin-3-one |
|---|---|
| PubChem CID | 6936217 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | (1S)-1-phenyl-2,4-dihydro-1H-benzo[f]quinazolin-3-one |
| SMILES | O=C1Nc2ccc3ccccc3c2[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C18H14N2O/c21-18-19-15-11-10-12-6-4-5-9-14(12)16(15)17(20-18)13-7-2-1-3-8-13/h1-11,17H,(H2,19,20,21)/t17-/m0/s1 |
| InChIKey | RRHGXVHHJNHTMD-KRWDZBQOSA-N |
| XLogP | 4.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |