C19H14N2O3 — CID 2857782
1-(3-nitrophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one (PubChem CID 2857782) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one.
| Compound Name | 1-(3-nitrophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 2857782 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-(3-nitrophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one |
| SMILES | O=C1CC(c2cccc([N+](=O)[O-])c2)c2c(ccc3ccccc23)N1 |
| InChI | InChI=1S/C19H14N2O3/c22-18-11-16(13-5-3-6-14(10-13)21(23)24)19-15-7-2-1-4-12(15)8-9-17(19)20-18/h1-10,16H,11H2,(H,20,22) |
| InChIKey | OULQVGXMYCRFAL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|