C19H13Cl2NO — CID 673088
(1S)-1-(2,4-dichlorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one (PubChem CID 673088) has the molecular formula C19H13Cl2NO and a molecular weight of 342.23 g/mol. Its IUPAC name is (1S)-1-(2,4-dichlorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one.
| Compound Name | (1S)-1-(2,4-dichlorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 673088 |
| Molecular Formula | C19H13Cl2NO |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | (1S)-1-(2,4-dichlorophenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one |
| SMILES | O=C1C[C@H](c2ccc(Cl)cc2Cl)c2c(ccc3ccccc23)N1 |
| InChI | InChI=1S/C19H13Cl2NO/c20-12-6-7-14(16(21)9-12)15-10-18(23)22-17-8-5-11-3-1-2-4-13(11)19(15)17/h1-9,15H,10H2,(H,22,23)/t15-/m1/s1 |
| InChIKey | OXKAFJDIRGFIAB-OAHLLOKOSA-N |
| XLogP | 5.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |