C19H12Cl2N4O2 — CID 135924901
(6S)-6-(2,4-dichlorophenyl)-1,3,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),10,12,14,16-pentaene-4,8-dione (PubChem CID 135924901) has the molecular formula C19H12Cl2N4O2 and a molecular weight of 399.24 g/mol. Its IUPAC name is (6S)-6-(2,4-dichlorophenyl)-1,3,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),10,12,14,16-pentaene-4,8-dione.
| Compound Name | (6S)-6-(2,4-dichlorophenyl)-1,3,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),10,12,14,16-pentaene-4,8-dione |
|---|---|
| PubChem CID | 135924901 |
| Molecular Formula | C19H12Cl2N4O2 |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | (6S)-6-(2,4-dichlorophenyl)-1,3,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),10,12,14,16-pentaene-4,8-dione |
| SMILES | O=C1C[C@H](c2ccc(Cl)cc2Cl)c2c(n3c(nc4ccccc43)[nH]c2=O)N1 |
| InChI | InChI=1S/C19H12Cl2N4O2/c20-9-5-6-10(12(21)7-9)11-8-15(26)23-17-16(11)18(27)24-19-22-13-3-1-2-4-14(13)25(17)19/h1-7,11H,8H2,(H,23,26)(H,22,24,27)/t11-/m1/s1 |
| InChIKey | IUCVNIJOSAGKKE-LLVKDONJSA-N |
| XLogP | 3.96 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |