C22H20N4O5 — CID 135952578
(6S)-6-(2,3,4-trimethoxyphenyl)-1,3,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),10,12,14,16-pentaene-4,8-dione (PubChem CID 135952578) has the molecular formula C22H20N4O5 and a molecular weight of 420.43 g/mol. Its IUPAC name is (6S)-6-(2,3,4-trimethoxyphenyl)-1,3,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),10,12,14,16-pentaene-4,8-dione.
| Compound Name | (6S)-6-(2,3,4-trimethoxyphenyl)-1,3,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),10,12,14,16-pentaene-4,8-dione |
|---|---|
| PubChem CID | 135952578 |
| Molecular Formula | C22H20N4O5 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (6S)-6-(2,3,4-trimethoxyphenyl)-1,3,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),10,12,14,16-pentaene-4,8-dione |
| SMILES | COc1ccc([C@@H]2CC(=O)Nc3c2c(=O)[nH]c2nc4ccccc4n32)c(OC)c1OC |
| InChI | InChI=1S/C22H20N4O5/c1-29-15-9-8-11(18(30-2)19(15)31-3)12-10-16(27)24-20-17(12)21(28)25-22-23-13-6-4-5-7-14(13)26(20)22/h4-9,12H,10H2,1-3H3,(H,24,27)(H,23,25,28)/t12-/m0/s1 |
| InChIKey | UMBWNQKMGDXDJA-LBPRGKRZSA-N |
| XLogP | 2.68 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |