C28H23FN4O4 — CID 42556449
(6R)-6-(2,3-dimethoxyphenyl)-9-[(4-fluorophenyl)methyl]-1,3,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),10,12,14,16-pentaene-4,8-dione (PubChem CID 42556449) has the molecular formula C28H23FN4O4 and a molecular weight of 498.51 g/mol. Its IUPAC name is (6R)-6-(2,3-dimethoxyphenyl)-9-[(4-fluorophenyl)methyl]-1,3,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),10,12,14,16-pentaene-4,8-dione.
| Compound Name | (6R)-6-(2,3-dimethoxyphenyl)-9-[(4-fluorophenyl)methyl]-1,3,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),10,12,14,16-pentaene-4,8-dione |
|---|---|
| PubChem CID | 42556449 |
| Molecular Formula | C28H23FN4O4 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | (6R)-6-(2,3-dimethoxyphenyl)-9-[(4-fluorophenyl)methyl]-1,3,9,11-tetrazatetracyclo[8.7.0.02,7.012,17]heptadeca-2(7),10,12,14,16-pentaene-4,8-dione |
| SMILES | COc1cccc([C@H]2CC(=O)Nc3c2c(=O)n(Cc2ccc(F)cc2)c2nc4ccccc4n32)c1OC |
| InChI | InChI=1S/C28H23FN4O4/c1-36-22-9-5-6-18(25(22)37-2)19-14-23(34)31-26-24(19)27(35)32(15-16-10-12-17(29)13-11-16)28-30-20-7-3-4-8-21(20)33(26)28/h3-13,19H,14-15H2,1-2H3,(H,31,34)/t19-/m1/s1 |
| InChIKey | DXKUTDWNLNRFOJ-LJQANCHMSA-N |
| XLogP | 4.33 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |