C21H19NO2 — CID 2231068
(1R)-1-(3-ethoxyphenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one (PubChem CID 2231068) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (1R)-1-(3-ethoxyphenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one.
| Compound Name | (1R)-1-(3-ethoxyphenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 2231068 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (1R)-1-(3-ethoxyphenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one |
| SMILES | CCOc1cccc([C@H]2CC(=O)Nc3ccc4ccccc4c32)c1 |
| InChI | InChI=1S/C21H19NO2/c1-2-24-16-8-5-7-15(12-16)18-13-20(23)22-19-11-10-14-6-3-4-9-17(14)21(18)19/h3-12,18H,2,13H2,1H3,(H,22,23)/t18-/m1/s1 |
| InChIKey | CQURRCZJVVMUNR-GOSISDBHSA-N |
| XLogP | 4.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |