C22H21NO3 — CID 2234146
(1S)-1-(4-ethoxy-3-methoxyphenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one (PubChem CID 2234146) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is (1S)-1-(4-ethoxy-3-methoxyphenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one.
| Compound Name | (1S)-1-(4-ethoxy-3-methoxyphenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 2234146 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (1S)-1-(4-ethoxy-3-methoxyphenyl)-2,4-dihydro-1H-benzo[f]quinolin-3-one |
| SMILES | CCOc1ccc([C@@H]2CC(=O)Nc3ccc4ccccc4c32)cc1OC |
| InChI | InChI=1S/C22H21NO3/c1-3-26-19-11-9-15(12-20(19)25-2)17-13-21(24)23-18-10-8-14-6-4-5-7-16(14)22(17)18/h4-12,17H,3,13H2,1-2H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | PKLJEOQSSSVFFF-KRWDZBQOSA-N |
| XLogP | 4.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |