C17H16N2O3 — CID 2916903
6,7-dimethyl-4-(3-nitrophenyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 2916903) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 6,7-dimethyl-4-(3-nitrophenyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6,7-dimethyl-4-(3-nitrophenyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 2916903 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 6,7-dimethyl-4-(3-nitrophenyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1cc2c(cc1C)C(c1cccc([N+](=O)[O-])c1)CC(=O)N2 |
| InChI | InChI=1S/C17H16N2O3/c1-10-6-15-14(9-17(20)18-16(15)7-11(10)2)12-4-3-5-13(8-12)19(21)22/h3-8,14H,9H2,1-2H3,(H,18,20) |
| InChIKey | QAUKYGUCLDVAMS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|