C18H16N2O5 — CID 2972968
9-(4-methyl-3-nitrophenyl)-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one (PubChem CID 2972968) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is 9-(4-methyl-3-nitrophenyl)-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one.
| Compound Name | 9-(4-methyl-3-nitrophenyl)-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one |
|---|---|
| PubChem CID | 2972968 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 9-(4-methyl-3-nitrophenyl)-3,6,8,9-tetrahydro-2H-[1,4]dioxino[2,3-g]quinolin-7-one |
| SMILES | Cc1ccc(C2CC(=O)Nc3cc4c(cc32)OCCO4)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16N2O5/c1-10-2-3-11(6-15(10)20(22)23)12-8-18(21)19-14-9-17-16(7-13(12)14)24-4-5-25-17/h2-3,6-7,9,12H,4-5,8H2,1H3,(H,19,21) |
| InChIKey | QTRPMMFYDUSLQY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|