C19H20N2O5 — CID 17312443
6,7-diethoxy-4-(4-nitrophenyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 17312443) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 6,7-diethoxy-4-(4-nitrophenyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6,7-diethoxy-4-(4-nitrophenyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 17312443 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 6,7-diethoxy-4-(4-nitrophenyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCOc1cc2c(cc1OCC)C(c1ccc([N+](=O)[O-])cc1)CC(=O)N2 |
| InChI | InChI=1S/C19H20N2O5/c1-3-25-17-9-15-14(12-5-7-13(8-6-12)21(23)24)10-19(22)20-16(15)11-18(17)26-4-2/h5-9,11,14H,3-4,10H2,1-2H3,(H,20,22) |
| InChIKey | TWCGQUAIASWYBF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|