C23H29NO4 — CID 27521012
(4R)-4-(2-butoxyphenyl)-6,7-diethoxy-3,4-dihydro-1H-quinolin-2-one (PubChem CID 27521012) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is (4R)-4-(2-butoxyphenyl)-6,7-diethoxy-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | (4R)-4-(2-butoxyphenyl)-6,7-diethoxy-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 27521012 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | (4R)-4-(2-butoxyphenyl)-6,7-diethoxy-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCCCOc1ccccc1[C@@H]1CC(=O)Nc2cc(OCC)c(OCC)cc21 |
| InChI | InChI=1S/C23H29NO4/c1-4-7-12-28-20-11-9-8-10-16(20)17-14-23(25)24-19-15-22(27-6-3)21(26-5-2)13-18(17)19/h8-11,13,15,17H,4-7,12,14H2,1-3H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | BXSLKGARFGYQQU-KRWDZBQOSA-N |
| XLogP | 5.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|