C25H19N3O — CID 7745751
(4S)-4,6-diphenyl-5-quinolin-2-yl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 7745751) has the molecular formula C25H19N3O and a molecular weight of 377.45 g/mol. Its IUPAC name is (4S)-4,6-diphenyl-5-quinolin-2-yl-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | (4S)-4,6-diphenyl-5-quinolin-2-yl-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 7745751 |
| Molecular Formula | C25H19N3O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | (4S)-4,6-diphenyl-5-quinolin-2-yl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | O=C1NC(c2ccccc2)=C(c2ccc3ccccc3n2)[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C25H19N3O/c29-25-27-23(18-10-3-1-4-11-18)22(24(28-25)19-12-5-2-6-13-19)21-16-15-17-9-7-8-14-20(17)26-21/h1-16,23H,(H2,27,28,29)/t23-/m0/s1 |
| InChIKey | UDAZBGDGKZRKEK-QHCPKHFHSA-N |
| XLogP | 5.16 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |