C16H13N3O3 — CID 555860
5-nitro-4,6-diphenyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 555860) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 5-nitro-4,6-diphenyl-3,4-dihydro-1H-pyrimidin-2-one.
| Compound Name | 5-nitro-4,6-diphenyl-3,4-dihydro-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 555860 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 5-nitro-4,6-diphenyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | O=C1NC(c2ccccc2)=C([N+](=O)[O-])C(c2ccccc2)N1 |
| InChI | InChI=1S/C16H13N3O3/c20-16-17-13(11-7-3-1-4-8-11)15(19(21)22)14(18-16)12-9-5-2-6-10-12/h1-10,13H,(H2,17,18,20) |
| InChIKey | MNSGYEZSEDWFPL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|