C36H24O4 — CID 11477920
(14R,15R)-14,15-diphenyl-12,17-dioxapentacyclo[16.8.0.02,11.03,8.021,26]hexacosa-1(18),2(11),3,5,7,9,19,21,23,25-decaene-13,16-dione (PubChem CID 11477920) has the molecular formula C36H24O4 and a molecular weight of 520.58 g/mol. Its IUPAC name is (14R,15R)-14,15-diphenyl-12,17-dioxapentacyclo[16.8.0.02,11.03,8.021,26]hexacosa-1(18),2(11),3,5,7,9,19,21,23,25-decaene-13,16-dione.
| Compound Name | (14R,15R)-14,15-diphenyl-12,17-dioxapentacyclo[16.8.0.02,11.03,8.021,26]hexacosa-1(18),2(11),3,5,7,9,19,21,23,25-decaene-13,16-dione |
|---|---|
| PubChem CID | 11477920 |
| Molecular Formula | C36H24O4 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (14R,15R)-14,15-diphenyl-12,17-dioxapentacyclo[16.8.0.02,11.03,8.021,26]hexacosa-1(18),2(11),3,5,7,9,19,21,23,25-decaene-13,16-dione |
| SMILES | O=C1Oc2ccc3ccccc3c2-c2c(ccc3ccccc23)OC(=O)[C@@H](c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C36H24O4/c37-35-31(25-13-3-1-4-14-25)32(26-15-5-2-6-16-26)36(38)40-30-22-20-24-12-8-10-18-28(24)34(30)33-27-17-9-7-11-23(27)19-21-29(33)39-35/h1-22,31-32H/t31-,32-/m0/s1 |
| InChIKey | XAIRMAXGCFITTJ-ACHIHNKUSA-N |
| XLogP | 8.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|