C32H22N2O6 — CID 126342802
(4S,5S,9S,10S)-7-(2-methyl-4-nitrophenyl)-4-phenyl-12-oxa-7-azapentacyclo[11.8.0.02,10.05,9.016,21]henicosa-1(13),2,14,16,18,20-hexaene-6,8,11-trione (PubChem CID 126342802) has the molecular formula C32H22N2O6 and a molecular weight of 530.54 g/mol. Its IUPAC name is (4S,5S,9S,10S)-7-(2-methyl-4-nitrophenyl)-4-phenyl-12-oxa-7-azapentacyclo[11.8.0.02,10.05,9.016,21]henicosa-1(13),2,14,16,18,20-hexaene-6,8,11-trione.
| Compound Name | (4S,5S,9S,10S)-7-(2-methyl-4-nitrophenyl)-4-phenyl-12-oxa-7-azapentacyclo[11.8.0.02,10.05,9.016,21]henicosa-1(13),2,14,16,18,20-hexaene-6,8,11-trione |
|---|---|
| PubChem CID | 126342802 |
| Molecular Formula | C32H22N2O6 |
| Molecular Weight | 530.54 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | (4S,5S,9S,10S)-7-(2-methyl-4-nitrophenyl)-4-phenyl-12-oxa-7-azapentacyclo[11.8.0.02,10.05,9.016,21]henicosa-1(13),2,14,16,18,20-hexaene-6,8,11-trione |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N1C(=O)[C@@H]2[C@@H]3C(=O)Oc4ccc5ccccc5c4C3=C[C@H](c3ccccc3)[C@@H]2C1=O |
| InChI | InChI=1S/C32H22N2O6/c1-17-15-20(34(38)39)12-13-24(17)33-30(35)27-22(18-7-3-2-4-8-18)16-23-26-21-10-6-5-9-19(21)11-14-25(26)40-32(37)28(23)29(27)31(33)36/h2-16,22,27-29H,1H3/t22-,27+,28-,29+/m1/s1 |
| InChIKey | USBKVMWMUCVHAX-URENDEMCSA-N |
| XLogP | 5.58 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|