C29H21NO6 — CID 126343290
(3aS,3bS,11S,11aR)-11-(1,3-benzodioxol-5-yl)-7-methyl-2-phenyl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione (PubChem CID 126343290) has the molecular formula C29H21NO6 and a molecular weight of 479.49 g/mol. Its IUPAC name is (3aS,3bS,11S,11aR)-11-(1,3-benzodioxol-5-yl)-7-methyl-2-phenyl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione.
| Compound Name | (3aS,3bS,11S,11aR)-11-(1,3-benzodioxol-5-yl)-7-methyl-2-phenyl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione |
|---|---|
| PubChem CID | 126343290 |
| Molecular Formula | C29H21NO6 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | (3aS,3bS,11S,11aR)-11-(1,3-benzodioxol-5-yl)-7-methyl-2-phenyl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione |
| SMILES | Cc1ccc2c(c1)OC(=O)[C@@H]1C2=C[C@H](c2ccc3c(c2)OCO3)[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C29H21NO6/c1-15-7-9-18-20-13-19(16-8-10-21-23(12-16)35-14-34-21)24-26(25(20)29(33)36-22(18)11-15)28(32)30(27(24)31)17-5-3-2-4-6-17/h2-13,19,24-26H,14H2,1H3/t19-,24-,25-,26+/m1/s1 |
| InChIKey | YFQABSJYVSWBKQ-BBXSYUKCSA-N |
| XLogP | 4.25 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|