C29H22ClNO5 — CID 126337197
(3aR,3bR,11R,11aR)-2-(4-chlorophenyl)-11-(4-methoxyphenyl)-7-methyl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione (PubChem CID 126337197) has the molecular formula C29H22ClNO5 and a molecular weight of 499.95 g/mol. Its IUPAC name is (3aR,3bR,11R,11aR)-2-(4-chlorophenyl)-11-(4-methoxyphenyl)-7-methyl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione.
| Compound Name | (3aR,3bR,11R,11aR)-2-(4-chlorophenyl)-11-(4-methoxyphenyl)-7-methyl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione |
|---|---|
| PubChem CID | 126337197 |
| Molecular Formula | C29H22ClNO5 |
| Molecular Weight | 499.95 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | (3aR,3bR,11R,11aR)-2-(4-chlorophenyl)-11-(4-methoxyphenyl)-7-methyl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione |
| SMILES | COc1ccc([C@@H]2C=C3c4ccc(C)cc4OC(=O)[C@@H]3[C@@H]3C(=O)N(c4ccc(Cl)cc4)C(=O)[C@@H]32)cc1 |
| InChI | InChI=1S/C29H22ClNO5/c1-15-3-12-20-22-14-21(16-4-10-19(35-2)11-5-16)24-26(25(22)29(34)36-23(20)13-15)28(33)31(27(24)32)18-8-6-17(30)7-9-18/h3-14,21,24-26H,1-2H3/t21-,24+,25-,26+/m0/s1 |
| InChIKey | CDDFJCZFZNVYLL-XDWXJERXSA-N |
| XLogP | 5.18 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.95 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|