C33H23NO6 — CID 126338436
(3aR,3bS,11S,11aS)-11-(1,3-benzodioxol-5-yl)-7-methyl-2-naphthalen-2-yl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione (PubChem CID 126338436) has the molecular formula C33H23NO6 and a molecular weight of 529.55 g/mol. Its IUPAC name is (3aR,3bS,11S,11aS)-11-(1,3-benzodioxol-5-yl)-7-methyl-2-naphthalen-2-yl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione.
| Compound Name | (3aR,3bS,11S,11aS)-11-(1,3-benzodioxol-5-yl)-7-methyl-2-naphthalen-2-yl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione |
|---|---|
| PubChem CID | 126338436 |
| Molecular Formula | C33H23NO6 |
| Molecular Weight | 529.55 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | (3aR,3bS,11S,11aS)-11-(1,3-benzodioxol-5-yl)-7-methyl-2-naphthalen-2-yl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione |
| SMILES | Cc1ccc2c(c1)OC(=O)[C@@H]1C2=C[C@H](c2ccc3c(c2)OCO3)[C@@H]2C(=O)N(c3ccc4ccccc4c3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C33H23NO6/c1-17-6-10-22-24-15-23(20-8-11-25-27(14-20)39-16-38-25)28-30(29(24)33(37)40-26(22)12-17)32(36)34(31(28)35)21-9-7-18-4-2-3-5-19(18)13-21/h2-15,23,28-30H,16H2,1H3/t23-,28+,29-,30-/m1/s1 |
| InChIKey | HITXQIQDSNMCFN-OQTWNIQDSA-N |
| XLogP | 5.40 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|