C31H21NO4 — CID 126342301
(4S,5S,9S,10R)-4,7-diphenyl-12-oxa-7-azapentacyclo[11.8.0.02,10.05,9.016,21]henicosa-1(13),2,14,16,18,20-hexaene-6,8,11-trione (PubChem CID 126342301) has the molecular formula C31H21NO4 and a molecular weight of 471.51 g/mol. Its IUPAC name is (4S,5S,9S,10R)-4,7-diphenyl-12-oxa-7-azapentacyclo[11.8.0.02,10.05,9.016,21]henicosa-1(13),2,14,16,18,20-hexaene-6,8,11-trione.
| Compound Name | (4S,5S,9S,10R)-4,7-diphenyl-12-oxa-7-azapentacyclo[11.8.0.02,10.05,9.016,21]henicosa-1(13),2,14,16,18,20-hexaene-6,8,11-trione |
|---|---|
| PubChem CID | 126342301 |
| Molecular Formula | C31H21NO4 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | (4S,5S,9S,10R)-4,7-diphenyl-12-oxa-7-azapentacyclo[11.8.0.02,10.05,9.016,21]henicosa-1(13),2,14,16,18,20-hexaene-6,8,11-trione |
| SMILES | O=C1Oc2ccc3ccccc3c2C2=C[C@H](c3ccccc3)[C@@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]3[C@@H]12 |
| InChI | InChI=1S/C31H21NO4/c33-29-26-22(18-9-3-1-4-10-18)17-23-25-21-14-8-7-11-19(21)15-16-24(25)36-31(35)27(23)28(26)30(34)32(29)20-12-5-2-6-13-20/h1-17,22,26-28H/t22-,26+,27+,28+/m1/s1 |
| InChIKey | SREDWXRFEGOQLV-DRBLOIPVSA-N |
| XLogP | 5.36 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|