C33H25NO5 — CID 126342857
(4R,5S,9R,10R)-4-(4-methoxyphenyl)-7-(4-methylphenyl)-12-oxa-7-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosa-1(13),2,14,16,18,20-hexaene-6,8,11-trione (PubChem CID 126342857) has the molecular formula C33H25NO5 and a molecular weight of 515.57 g/mol. Its IUPAC name is (4R,5S,9R,10R)-4-(4-methoxyphenyl)-7-(4-methylphenyl)-12-oxa-7-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosa-1(13),2,14,16,18,20-hexaene-6,8,11-trione.
| Compound Name | (4R,5S,9R,10R)-4-(4-methoxyphenyl)-7-(4-methylphenyl)-12-oxa-7-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosa-1(13),2,14,16,18,20-hexaene-6,8,11-trione |
|---|---|
| PubChem CID | 126342857 |
| Molecular Formula | C33H25NO5 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | (4R,5S,9R,10R)-4-(4-methoxyphenyl)-7-(4-methylphenyl)-12-oxa-7-azapentacyclo[11.8.0.02,10.05,9.014,19]henicosa-1(13),2,14,16,18,20-hexaene-6,8,11-trione |
| SMILES | COc1ccc([C@@H]2C=C3c4ccc5ccccc5c4OC(=O)[C@@H]3[C@@H]3C(=O)N(c4ccc(C)cc4)C(=O)[C@H]32)cc1 |
| InChI | InChI=1S/C33H25NO5/c1-18-7-12-21(13-8-18)34-31(35)27-25(20-9-14-22(38-2)15-10-20)17-26-24-16-11-19-5-3-4-6-23(19)30(24)39-33(37)28(26)29(27)32(34)36/h3-17,25,27-29H,1-2H3/t25-,27-,28-,29+/m0/s1 |
| InChIKey | VQGCPVQUKFIUJN-RDPOUHODSA-N |
| XLogP | 5.68 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|