C31H27NO5 — CID 126338072
(3aS,3bR,11R,11aS)-2-(2,4-dimethylphenyl)-11-(4-methoxyphenyl)-7-methyl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione (PubChem CID 126338072) has the molecular formula C31H27NO5 and a molecular weight of 493.56 g/mol. Its IUPAC name is (3aS,3bR,11R,11aS)-2-(2,4-dimethylphenyl)-11-(4-methoxyphenyl)-7-methyl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione.
| Compound Name | (3aS,3bR,11R,11aS)-2-(2,4-dimethylphenyl)-11-(4-methoxyphenyl)-7-methyl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione |
|---|---|
| PubChem CID | 126338072 |
| Molecular Formula | C31H27NO5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | (3aS,3bR,11R,11aS)-2-(2,4-dimethylphenyl)-11-(4-methoxyphenyl)-7-methyl-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione |
| SMILES | COc1ccc([C@@H]2C=C3c4ccc(C)cc4OC(=O)[C@@H]3[C@H]3C(=O)N(c4ccc(C)cc4C)C(=O)[C@H]32)cc1 |
| InChI | InChI=1S/C31H27NO5/c1-16-6-12-24(18(3)13-16)32-29(33)26-22(19-7-9-20(36-4)10-8-19)15-23-21-11-5-17(2)14-25(21)37-31(35)27(23)28(26)30(32)34/h5-15,22,26-28H,1-4H3/t22-,26-,27-,28-/m0/s1 |
| InChIKey | FQXWVXXHVGYTOI-ACNFANBVSA-N |
| XLogP | 5.14 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|