C30H22N2O8 — CID 126339348
(3aR,3bS,11S,11aR)-11-(1,3-benzodioxol-5-yl)-7-methyl-2-(2-methyl-4-nitrophenyl)-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione (PubChem CID 126339348) has the molecular formula C30H22N2O8 and a molecular weight of 538.51 g/mol. Its IUPAC name is (3aR,3bS,11S,11aR)-11-(1,3-benzodioxol-5-yl)-7-methyl-2-(2-methyl-4-nitrophenyl)-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione.
| Compound Name | (3aR,3bS,11S,11aR)-11-(1,3-benzodioxol-5-yl)-7-methyl-2-(2-methyl-4-nitrophenyl)-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione |
|---|---|
| PubChem CID | 126339348 |
| Molecular Formula | C30H22N2O8 |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | (3aR,3bS,11S,11aR)-11-(1,3-benzodioxol-5-yl)-7-methyl-2-(2-methyl-4-nitrophenyl)-3a,3b,11,11a-tetrahydrochromeno[3,4-e]isoindole-1,3,4-trione |
| SMILES | Cc1ccc2c(c1)OC(=O)[C@@H]1C2=C[C@H](c2ccc3c(c2)OCO3)[C@H]2C(=O)N(c3ccc([N+](=O)[O-])cc3C)C(=O)[C@@H]12 |
| InChI | InChI=1S/C30H22N2O8/c1-14-3-6-18-20-12-19(16-4-8-22-24(11-16)39-13-38-22)25-27(26(20)30(35)40-23(18)9-14)29(34)31(28(25)33)21-7-5-17(32(36)37)10-15(21)2/h3-12,19,25-27H,13H2,1-2H3/t19-,25-,26-,27-/m1/s1 |
| InChIKey | ILDSYQPSQHCAGJ-CEWWTIOHSA-N |
| XLogP | 4.46 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|