C28H13NO8 — CID 146369901
23-phenyl-6,16-dioxa-23-azaheptacyclo[9.9.5.02,10.04,8.012,20.014,18.021,25]pentacosa-2,4(8),9,12,14(18),19-hexaene-5,7,15,17,22,24-hexone (PubChem CID 146369901) has the molecular formula C28H13NO8 and a molecular weight of 491.41 g/mol. Its IUPAC name is 23-phenyl-6,16-dioxa-23-azaheptacyclo[9.9.5.02,10.04,8.012,20.014,18.021,25]pentacosa-2,4(8),9,12,14(18),19-hexaene-5,7,15,17,22,24-hexone.
| Compound Name | 23-phenyl-6,16-dioxa-23-azaheptacyclo[9.9.5.02,10.04,8.012,20.014,18.021,25]pentacosa-2,4(8),9,12,14(18),19-hexaene-5,7,15,17,22,24-hexone |
|---|---|
| PubChem CID | 146369901 |
| Molecular Formula | C28H13NO8 |
| Molecular Weight | 491.41 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 23-phenyl-6,16-dioxa-23-azaheptacyclo[9.9.5.02,10.04,8.012,20.014,18.021,25]pentacosa-2,4(8),9,12,14(18),19-hexaene-5,7,15,17,22,24-hexone |
| SMILES | O=C1OC(=O)c2cc3c(cc21)C1c2cc4c(cc2C3C2C(=O)N(c3ccccc3)C(=O)C12)C(=O)OC4=O |
| InChI | InChI=1S/C28H13NO8/c30-23-21-19-11-6-15-16(26(33)36-25(15)32)7-12(11)20(22(21)24(31)29(23)10-4-2-1-3-5-10)14-9-18-17(8-13(14)19)27(34)37-28(18)35/h1-9,19-22H |
| InChIKey | NIWCAZJPYFKSAM-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 124.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|