C38H25F6N3O2 — CID 146369155
4,11-bis[4-amino-2-(trifluoromethyl)phenyl]-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione (PubChem CID 146369155) has the molecular formula C38H25F6N3O2 and a molecular weight of 669.63 g/mol. Its IUPAC name is 4,11-bis[4-amino-2-(trifluoromethyl)phenyl]-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione.
| Compound Name | 4,11-bis[4-amino-2-(trifluoromethyl)phenyl]-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione |
|---|---|
| PubChem CID | 146369155 |
| Molecular Formula | C38H25F6N3O2 |
| Molecular Weight | 669.63 g/mol |
| Exact Mass | 669.19 |
| IUPAC Name | 4,11-bis[4-amino-2-(trifluoromethyl)phenyl]-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione |
| SMILES | Nc1ccc(-c2ccc3c(c2)C2c4ccc(-c5ccc(N)cc5C(F)(F)F)cc4C3C3C(=O)N(c4ccccc4)C(=O)C23)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C38H25F6N3O2/c39-37(40,41)29-16-20(45)8-12-23(29)18-6-10-25-27(14-18)32-26-11-7-19(24-13-9-21(46)17-30(24)38(42,43)44)15-28(26)31(25)33-34(32)36(49)47(35(33)48)22-4-2-1-3-5-22/h1-17,31-34H,45-46H2 |
| InChIKey | BRXZPBYJBQEPQK-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.63 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|