C22H15NO2S — CID 98207922
(1R,12R,13S,17S)-15-phenyl-18-thia-15-azapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-2,4,6,8,10-pentaene-14,16-dione (PubChem CID 98207922) has the molecular formula C22H15NO2S and a molecular weight of 357.43 g/mol. Its IUPAC name is (1R,12R,13S,17S)-15-phenyl-18-thia-15-azapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-2,4,6,8,10-pentaene-14,16-dione.
| Compound Name | (1R,12R,13S,17S)-15-phenyl-18-thia-15-azapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-2,4,6,8,10-pentaene-14,16-dione |
|---|---|
| PubChem CID | 98207922 |
| Molecular Formula | C22H15NO2S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | (1R,12R,13S,17S)-15-phenyl-18-thia-15-azapentacyclo[10.5.1.02,11.04,9.013,17]octadeca-2,4,6,8,10-pentaene-14,16-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1ccccc1)[C@H]1S[C@H]2c2cc3ccccc3cc21 |
| InChI | InChI=1S/C22H15NO2S/c24-21-17-18(22(25)23(21)14-8-2-1-3-9-14)20-16-11-13-7-5-4-6-12(13)10-15(16)19(17)26-20/h1-11,17-20H/t17-,18-,19+,20+/m1/s1 |
| InChIKey | FKHRJQRQRDBPQA-ZRNYENFQSA-N |
| XLogP | 4.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|