C21H15NO2S — CID 15194241
(12R,16R)-14-phenyl-11-thia-14-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9-pentaene-13,15-dione (PubChem CID 15194241) has the molecular formula C21H15NO2S and a molecular weight of 345.42 g/mol. Its IUPAC name is (12R,16R)-14-phenyl-11-thia-14-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9-pentaene-13,15-dione.
| Compound Name | (12R,16R)-14-phenyl-11-thia-14-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9-pentaene-13,15-dione |
|---|---|
| PubChem CID | 15194241 |
| Molecular Formula | C21H15NO2S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | (12R,16R)-14-phenyl-11-thia-14-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3,5,7,9-pentaene-13,15-dione |
| SMILES | O=C1[C@H]2Cc3cc4ccccc4cc3S[C@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C21H15NO2S/c23-20-17-11-15-10-13-6-4-5-7-14(13)12-18(15)25-19(17)21(24)22(20)16-8-2-1-3-9-16/h1-10,12,17,19H,11H2/t17-,19+/m0/s1 |
| InChIKey | FAQUOJKJWCSCNU-PKOBYXMFSA-N |
| XLogP | 4.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|