C20H13Cl2N3O2 — CID 10524893
(6aS,9aR)-2,3-dichloro-8-phenyl-6,6a,9a,10-tetrahydroisoindolo[5,6-g]quinoxaline-7,9-dione (PubChem CID 10524893) has the molecular formula C20H13Cl2N3O2 and a molecular weight of 398.25 g/mol. Its IUPAC name is (6aS,9aR)-2,3-dichloro-8-phenyl-6,6a,9a,10-tetrahydroisoindolo[5,6-g]quinoxaline-7,9-dione.
| Compound Name | (6aS,9aR)-2,3-dichloro-8-phenyl-6,6a,9a,10-tetrahydroisoindolo[5,6-g]quinoxaline-7,9-dione |
|---|---|
| PubChem CID | 10524893 |
| Molecular Formula | C20H13Cl2N3O2 |
| Molecular Weight | 398.25 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | (6aS,9aR)-2,3-dichloro-8-phenyl-6,6a,9a,10-tetrahydroisoindolo[5,6-g]quinoxaline-7,9-dione |
| SMILES | O=C1[C@H]2Cc3cc4nc(Cl)c(Cl)nc4cc3C[C@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C20H13Cl2N3O2/c21-17-18(22)24-16-9-11-7-14-13(6-10(11)8-15(16)23-17)19(26)25(20(14)27)12-4-2-1-3-5-12/h1-5,8-9,13-14H,6-7H2/t13-,14+ |
| InChIKey | VVXYQIAABQQMCN-OKILXGFUSA-N |
| XLogP | 3.84 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|