C21H19ClN2O4 — CID 11165451
methyl (5aR,8aR,9S)-2-chloro-3,9-dimethyl-6,8-dioxo-7-phenyl-5a,8a-dihydro-5H-pyrrolo[3,4-g]quinoline-9-carboxylate (PubChem CID 11165451) has the molecular formula C21H19ClN2O4 and a molecular weight of 398.85 g/mol. Its IUPAC name is methyl (5aR,8aR,9S)-2-chloro-3,9-dimethyl-6,8-dioxo-7-phenyl-5a,8a-dihydro-5H-pyrrolo[3,4-g]quinoline-9-carboxylate.
| Compound Name | methyl (5aR,8aR,9S)-2-chloro-3,9-dimethyl-6,8-dioxo-7-phenyl-5a,8a-dihydro-5H-pyrrolo[3,4-g]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 11165451 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | methyl (5aR,8aR,9S)-2-chloro-3,9-dimethyl-6,8-dioxo-7-phenyl-5a,8a-dihydro-5H-pyrrolo[3,4-g]quinoline-9-carboxylate |
| SMILES | COC(=O)[C@]1(C)c2nc(Cl)c(C)cc2C[C@H]2C(=O)N(c3ccccc3)C(=O)[C@H]21 |
| InChI | InChI=1S/C21H19ClN2O4/c1-11-9-12-10-14-15(21(2,20(27)28-3)16(12)23-17(11)22)19(26)24(18(14)25)13-7-5-4-6-8-13/h4-9,14-15H,10H2,1-3H3/t14-,15+,21+/m1/s1 |
| InChIKey | UFNZHWUZVQLUCK-WIEQDCTASA-N |
| XLogP | 2.84 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|