C30H26N2O4 — CID 132539316
methyl (10R,11R,15S,16S)-12,14-dioxo-13-phenyl-16-[(E)-2-phenylethenyl]-1,13-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,5,7-triene-10-carboxylate (PubChem CID 132539316) has the molecular formula C30H26N2O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is methyl (10R,11R,15S,16S)-12,14-dioxo-13-phenyl-16-[(E)-2-phenylethenyl]-1,13-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,5,7-triene-10-carboxylate.
| Compound Name | methyl (10R,11R,15S,16S)-12,14-dioxo-13-phenyl-16-[(E)-2-phenylethenyl]-1,13-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,5,7-triene-10-carboxylate |
|---|---|
| PubChem CID | 132539316 |
| Molecular Formula | C30H26N2O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | methyl (10R,11R,15S,16S)-12,14-dioxo-13-phenyl-16-[(E)-2-phenylethenyl]-1,13-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-3,5,7-triene-10-carboxylate |
| SMILES | COC(=O)[C@]12Cc3ccccc3CN1[C@@H](/C=C/c1ccccc1)[C@H]1C(=O)N(c3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C30H26N2O4/c1-36-29(35)30-18-21-12-8-9-13-22(21)19-31(30)24(17-16-20-10-4-2-5-11-20)25-26(30)28(34)32(27(25)33)23-14-6-3-7-15-23/h2-17,24-26H,18-19H2,1H3/b17-16+/t24-,25+,26-,30+/m0/s1 |
| InChIKey | KNRSHLIYZFJVLM-NJCRRRADSA-N |
| XLogP | 3.86 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|