C20H15ClN2O4 — CID 139255988
methyl (3R,3aR,6aS)-5-(3-chlorophenyl)-4,6-dioxo-3-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 139255988) has the molecular formula C20H15ClN2O4 and a molecular weight of 382.80 g/mol. Its IUPAC name is methyl (3R,3aR,6aS)-5-(3-chlorophenyl)-4,6-dioxo-3-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (3R,3aR,6aS)-5-(3-chlorophenyl)-4,6-dioxo-3-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 139255988 |
| Molecular Formula | C20H15ClN2O4 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | methyl (3R,3aR,6aS)-5-(3-chlorophenyl)-4,6-dioxo-3-phenyl-3a,6a-dihydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)[C@@]1(c2ccccc2)N=C[C@H]2C(=O)N(c3cccc(Cl)c3)C(=O)[C@H]21 |
| InChI | InChI=1S/C20H15ClN2O4/c1-27-19(26)20(12-6-3-2-4-7-12)16-15(11-22-20)17(24)23(18(16)25)14-9-5-8-13(21)10-14/h2-11,15-16H,1H3/t15-,16+,20+/m1/s1 |
| InChIKey | CEJXVZFLNQLBBK-GUXCAODWSA-N |
| XLogP | 2.60 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|