C20H17NO2 — CID 164667716
(1R,10S,11R,15S)-13-phenyl-13-azatetracyclo[8.5.0.02,7.011,15]pentadeca-2,4,6-triene-12,14-dione (PubChem CID 164667716) has the molecular formula C20H17NO2 and a molecular weight of 303.36 g/mol. Its IUPAC name is (1R,10S,11R,15S)-13-phenyl-13-azatetracyclo[8.5.0.02,7.011,15]pentadeca-2,4,6-triene-12,14-dione.
| Compound Name | (1R,10S,11R,15S)-13-phenyl-13-azatetracyclo[8.5.0.02,7.011,15]pentadeca-2,4,6-triene-12,14-dione |
|---|---|
| PubChem CID | 164667716 |
| Molecular Formula | C20H17NO2 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | (1R,10S,11R,15S)-13-phenyl-13-azatetracyclo[8.5.0.02,7.011,15]pentadeca-2,4,6-triene-12,14-dione |
| SMILES | O=C1[C@@H]2[C@H]3CCc4ccccc4[C@H]3[C@@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C20H17NO2/c22-19-17-15-11-10-12-6-4-5-9-14(12)16(15)18(17)20(23)21(19)13-7-2-1-3-8-13/h1-9,15-18H,10-11H2/t15-,16+,17+,18-/m0/s1 |
| InChIKey | QOFPRTWXQSYUHM-MLHJIOFPSA-N |
| XLogP | 3.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|