C19H15NO2 — CID 164667723
(1R,9S,10R,14S)-12-phenyl-12-azatetracyclo[7.5.0.02,7.010,14]tetradeca-2,4,6-triene-11,13-dione (PubChem CID 164667723) has the molecular formula C19H15NO2 and a molecular weight of 289.33 g/mol. Its IUPAC name is (1R,9S,10R,14S)-12-phenyl-12-azatetracyclo[7.5.0.02,7.010,14]tetradeca-2,4,6-triene-11,13-dione.
| Compound Name | (1R,9S,10R,14S)-12-phenyl-12-azatetracyclo[7.5.0.02,7.010,14]tetradeca-2,4,6-triene-11,13-dione |
|---|---|
| PubChem CID | 164667723 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (1R,9S,10R,14S)-12-phenyl-12-azatetracyclo[7.5.0.02,7.010,14]tetradeca-2,4,6-triene-11,13-dione |
| SMILES | O=C1[C@@H]2[C@H]3Cc4ccccc4[C@H]3[C@@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C19H15NO2/c21-18-16-14-10-11-6-4-5-9-13(11)15(14)17(16)19(22)20(18)12-7-2-1-3-8-12/h1-9,14-17H,10H2/t14-,15+,16+,17-/m0/s1 |
| InChIKey | AAMCSPWLRSHNDM-HZMVEIRTSA-N |
| XLogP | 2.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|