C32H26N2O4 — CID 5192921
17-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 5192921) has the molecular formula C32H26N2O4 and a molecular weight of 502.57 g/mol. Its IUPAC name is 17-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 17-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 5192921 |
| Molecular Formula | C32H26N2O4 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | 17-[4-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1C2CCCCC2C(=O)N1c1ccc(N2C(=O)C3C4c5ccccc5C(c5ccccc54)C3C2=O)cc1 |
| InChI | InChI=1S/C32H26N2O4/c35-29-23-11-5-6-12-24(23)30(36)33(29)17-13-15-18(16-14-17)34-31(37)27-25-19-7-1-2-8-20(19)26(28(27)32(34)38)22-10-4-3-9-21(22)25/h1-4,7-10,13-16,23-28H,5-6,11-12H2 |
| InChIKey | ORZJXFWSHDYGJN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|