C28H28N2O4 — CID 124766153
(3aR,7aR)-2-[4-[4-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 124766153) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is (3aR,7aR)-2-[4-[4-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[4-[4-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 124766153 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (3aR,7aR)-2-[4-[4-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]phenyl]-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2CCCC[C@H]2C(=O)N1c1ccc(-c2ccc(N3C(=O)[C@@H]4CCCC[C@H]4C3=O)cc2)cc1 |
| InChI | InChI=1S/C28H28N2O4/c31-25-21-5-1-2-6-22(21)26(32)29(25)19-13-9-17(10-14-19)18-11-15-20(16-12-18)30-27(33)23-7-3-4-8-24(23)28(30)34/h9-16,21-24H,1-8H2/t21-,22-,23-,24-/m1/s1 |
| InChIKey | UGQMGCQEIMOUGG-MOUTVQLLSA-N |
| XLogP | 4.71 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|