C18H12N4O7 — CID 3852100
5-(2-methyl-4-nitrophenyl)-3-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 3852100) has the molecular formula C18H12N4O7 and a molecular weight of 396.32 g/mol. Its IUPAC name is 5-(2-methyl-4-nitrophenyl)-3-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 5-(2-methyl-4-nitrophenyl)-3-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 3852100 |
| Molecular Formula | C18H12N4O7 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 5-(2-methyl-4-nitrophenyl)-3-(4-nitrophenyl)-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N1C(=O)C2ON=C(c3ccc([N+](=O)[O-])cc3)C2C1=O |
| InChI | InChI=1S/C18H12N4O7/c1-9-8-12(22(27)28)6-7-13(9)20-17(23)14-15(19-29-16(14)18(20)24)10-2-4-11(5-3-10)21(25)26/h2-8,14,16H,1H3 |
| InChIKey | SFIBTYRWBSODOQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 145.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|